C11H14N4OS — CID 43366334
4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]aniline (PubChem CID 43366334) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]aniline.
| Compound Name | 4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]aniline |
|---|---|
| PubChem CID | 43366334 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]aniline |
| SMILES | Cn1cnnc1SCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C11H14N4OS/c1-15-8-13-14-11(15)17-7-6-16-10-4-2-9(12)3-5-10/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | BWWARNVGOXKSDP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|