C6H10FN3S — CID 131206964
3-(3-fluoropropylsulfanyl)-4-methyl-1,2,4-triazole (PubChem CID 131206964) has the molecular formula C6H10FN3S and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-(3-fluoropropylsulfanyl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(3-fluoropropylsulfanyl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 131206964 |
| Molecular Formula | C6H10FN3S |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-(3-fluoropropylsulfanyl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1SCCCF |
| InChI | InChI=1S/C6H10FN3S/c1-10-5-8-9-6(10)11-4-2-3-7/h5H,2-4H2,1H3 |
| InChIKey | ACBQKSDWMWIECT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|