C6H13ClN4S — CID 86262381
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine;hydrochloride (PubChem CID 86262381) has the molecular formula C6H13ClN4S and a molecular weight of 208.72 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine;hydrochloride.
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262381 |
| Molecular Formula | C6H13ClN4S |
| Molecular Weight | 208.72 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine;hydrochloride |
| SMILES | Cl.Cn1cnnc1SCCCN |
| InChI | InChI=1S/C6H12N4S.ClH/c1-10-5-8-9-6(10)11-4-2-3-7;/h5H,2-4,7H2,1H3;1H |
| InChIKey | UALAPABMOBITER-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.72 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|