C10H19N5S — CID 141181346
1-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine (PubChem CID 141181346) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine.
| Compound Name | 1-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine |
|---|---|
| PubChem CID | 141181346 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine |
| SMILES | Cn1cnnc1SCCCN1CCNCC1 |
| InChI | InChI=1S/C10H19N5S/c1-14-9-12-13-10(14)16-8-2-5-15-6-3-11-4-7-15/h9,11H,2-8H2,1H3 |
| InChIKey | SWJXEKXQWSXAGL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|