About 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine
5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 163468710) has the molecular formula C10H18N4S2
and a molecular weight of 258.42 g/mol. Its IUPAC name is 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine |
| PubChem CID | 163468710 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCCCN2CCNCC2)s1 |
| InChI | InChI=1S/C10H18N4S2/c11-10-13-8-9(16-10)15-7-1-4-14-5-2-12-3-6-14/h8,12H,1-7H2,(H2,11,13) |
| InChIKey | BUUZXADNXOCKPC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine (CID 163468710) is 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine is Nc1ncc(SCCCN2CCNCC2)s1.
What is the InChIKey of 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine?
The InChIKey is BUUZXADNXOCKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S2/c11-10-13-8-9(16-10)15-7-1-4-14-5-2-12-3-6-14/h8,12H,1-7H2,(H2,11,13).
What are the key properties of 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine?
5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine has a molecular weight of 258.42 g/mol, XLogP of 1.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 163468710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).