C10H18N4S2 — CID 163468710
5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 163468710) has the molecular formula C10H18N4S2 and a molecular weight of 258.42 g/mol. Its IUPAC name is 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163468710 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-(3-piperazin-1-ylpropylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCCCN2CCNCC2)s1 |
| InChI | InChI=1S/C10H18N4S2/c11-10-13-8-9(16-10)15-7-1-4-14-5-2-12-3-6-14/h8,12H,1-7H2,(H2,11,13) |
| InChIKey | BUUZXADNXOCKPC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|