C19H36N2S2 — CID 154328112
5-hexadecylsulfanyl-1,3-thiazol-2-amine (PubChem CID 154328112) has the molecular formula C19H36N2S2 and a molecular weight of 356.65 g/mol. Its IUPAC name is 5-hexadecylsulfanyl-1,3-thiazol-2-amine.
| Compound Name | 5-hexadecylsulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 154328112 |
| Molecular Formula | C19H36N2S2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 5-hexadecylsulfanyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCCCCCCCCCSc1cnc(N)s1 |
| InChI | InChI=1S/C19H36N2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-17-21-19(20)23-18/h17H,2-16H2,1H3,(H2,20,21) |
| InChIKey | YLRDIKAUVZXWEQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|