About 5-hexadecylsulfanyl-1,3-thiazol-2-amine
5-hexadecylsulfanyl-1,3-thiazol-2-amine (PubChem CID 154328112) has the molecular formula C19H36N2S2
and a molecular weight of 356.65 g/mol. Its IUPAC name is 5-hexadecylsulfanyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-hexadecylsulfanyl-1,3-thiazol-2-amine |
| PubChem CID | 154328112 |
| Molecular Formula | C19H36N2S2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 5-hexadecylsulfanyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCCCCCCCCCSc1cnc(N)s1 |
| InChI | InChI=1S/C19H36N2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-17-21-19(20)23-18/h17H,2-16H2,1H3,(H2,20,21) |
| InChIKey | YLRDIKAUVZXWEQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexadecylsulfanyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexadecylsulfanyl-1,3-thiazol-2-amine?
The IUPAC name of 5-hexadecylsulfanyl-1,3-thiazol-2-amine (CID 154328112) is 5-hexadecylsulfanyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-hexadecylsulfanyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-hexadecylsulfanyl-1,3-thiazol-2-amine is CCCCCCCCCCCCCCCCSc1cnc(N)s1.
What is the InChIKey of 5-hexadecylsulfanyl-1,3-thiazol-2-amine?
The InChIKey is YLRDIKAUVZXWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-17-21-19(20)23-18/h17H,2-16H2,1H3,(H2,20,21).
What are the key properties of 5-hexadecylsulfanyl-1,3-thiazol-2-amine?
5-hexadecylsulfanyl-1,3-thiazol-2-amine has a molecular weight of 356.65 g/mol, XLogP of 7.30, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexadecylsulfanyl-1,3-thiazol-2-amine is sourced from PubChem (CID 154328112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).