C28H40S5 — CID 71361773
2,5-bis(5-octylsulfanylthiophen-2-yl)thiophene (PubChem CID 71361773) has the molecular formula C28H40S5 and a molecular weight of 536.96 g/mol. Its IUPAC name is 2,5-bis(5-octylsulfanylthiophen-2-yl)thiophene.
| Compound Name | 2,5-bis(5-octylsulfanylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 71361773 |
| Molecular Formula | C28H40S5 |
| Molecular Weight | 536.96 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2,5-bis(5-octylsulfanylthiophen-2-yl)thiophene |
| SMILES | CCCCCCCCSc1ccc(-c2ccc(-c3ccc(SCCCCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C28H40S5/c1-3-5-7-9-11-13-21-29-27-19-17-25(32-27)23-15-16-24(31-23)26-18-20-28(33-26)30-22-14-12-10-8-6-4-2/h15-20H,3-14,21-22H2,1-2H3 |
| InChIKey | MNQSYRUVKOJNHT-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.96 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|