C46H64S4 — CID 10440027
2-decylsulfanyl-5-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(5-decylsulfanylthiophen-2-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]thiophene (PubChem CID 10440027) has the molecular formula C46H64S4 and a molecular weight of 745.29 g/mol. Its IUPAC name is 2-decylsulfanyl-5-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(5-decylsulfanylthiophen-2-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]thiophene.
| Compound Name | 2-decylsulfanyl-5-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(5-decylsulfanylthiophen-2-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]thiophene |
|---|---|
| PubChem CID | 10440027 |
| Molecular Formula | C46H64S4 |
| Molecular Weight | 745.29 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 2-decylsulfanyl-5-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(5-decylsulfanylthiophen-2-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]thiophene |
| SMILES | CCCCCCCCCCSc1ccc(/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/c2ccc(SCCCCCCCCCC)s2)s1 |
| InChI | InChI=1S/C46H64S4/c1-3-5-7-9-11-25-29-33-41-47-45-39-37-43(49-45)35-31-27-23-21-19-17-15-13-14-16-18-20-22-24-28-32-36-44-38-40-46(50-44)48-42-34-30-26-12-10-8-6-4-2/h13-24,27-28,31-32,35-40H,3-12,25-26,29-30,33-34,41-42H2,1-2H3/b14-13+,17-15+,18-16+,21-19+,22-20+,27-23+,28-24+,35-31+,36-32+ |
| InChIKey | GPFUKOHBRVDFHU-FAUVTZIJSA-N |
| XLogP | 16.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.29 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|