C34H52S12 — CID 15198189
2,5-bis[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole (PubChem CID 15198189) has the molecular formula C34H52S12 and a molecular weight of 845.59 g/mol. Its IUPAC name is 2,5-bis[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole.
| Compound Name | 2,5-bis[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole |
|---|---|
| PubChem CID | 15198189 |
| Molecular Formula | C34H52S12 |
| Molecular Weight | 845.59 g/mol |
| Exact Mass | 844.07 |
| IUPAC Name | 2,5-bis[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiole |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=C2SC3=C(S2)SC(=C2SC(SCCCCCC)=C(SCCCCCC)S2)S3)S1 |
| InChI | InChI=1S/C34H52S12/c1-5-9-13-17-21-35-25-26(36-22-18-14-10-6-2)40-29(39-25)31-43-33-34(44-31)46-32(45-33)30-41-27(37-23-19-15-11-7-3)28(42-30)38-24-20-16-12-8-4/h5-24H2,1-4H3 |
| InChIKey | PJVFCYQCHKSBDZ-UHFFFAOYSA-N |
| XLogP | 17.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.59 |
| LogP ≤ 5 | 17.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|