C18H28S6 — CID 15488141
2-(1,3-dithiol-2-ylidene)-4,5-bis(hexylsulfanyl)-1,3-dithiole (PubChem CID 15488141) has the molecular formula C18H28S6 and a molecular weight of 436.82 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4,5-bis(hexylsulfanyl)-1,3-dithiole.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-4,5-bis(hexylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 15488141 |
| Molecular Formula | C18H28S6 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-4,5-bis(hexylsulfanyl)-1,3-dithiole |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C18H28S6/c1-3-5-7-9-11-19-16-17(20-12-10-8-6-4-2)24-18(23-16)15-21-13-14-22-15/h13-14H,3-12H2,1-2H3 |
| InChIKey | LZSOEAGKGGCCPN-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|