C18H26Br2S6 — CID 15437517
2-[4,5-bis(bromomethyl)-1,3-dithiol-2-ylidene]-4,5-bis(pentylsulfanyl)-1,3-dithiole (PubChem CID 15437517) has the molecular formula C18H26Br2S6 and a molecular weight of 594.62 g/mol. Its IUPAC name is 2-[4,5-bis(bromomethyl)-1,3-dithiol-2-ylidene]-4,5-bis(pentylsulfanyl)-1,3-dithiole.
| Compound Name | 2-[4,5-bis(bromomethyl)-1,3-dithiol-2-ylidene]-4,5-bis(pentylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 15437517 |
| Molecular Formula | C18H26Br2S6 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 591.87 |
| IUPAC Name | 2-[4,5-bis(bromomethyl)-1,3-dithiol-2-ylidene]-4,5-bis(pentylsulfanyl)-1,3-dithiole |
| SMILES | CCCCCSC1=C(SCCCCC)SC(=C2SC(CBr)=C(CBr)S2)S1 |
| InChI | InChI=1S/C18H26Br2S6/c1-3-5-7-9-21-15-16(22-10-8-6-4-2)26-18(25-15)17-23-13(11-19)14(12-20)24-17/h3-12H2,1-2H3 |
| InChIKey | VUXNXWHDMZHBLQ-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|