C14H18I2S6 — CID 11125053
(2E)-4-butylsulfanyl-2-(4-butylsulfanyl-5-iodo-1,3-dithiol-2-ylidene)-5-iodo-1,3-dithiole (PubChem CID 11125053) has the molecular formula C14H18I2S6 and a molecular weight of 632.51 g/mol. Its IUPAC name is (2E)-4-butylsulfanyl-2-(4-butylsulfanyl-5-iodo-1,3-dithiol-2-ylidene)-5-iodo-1,3-dithiole.
| Compound Name | (2E)-4-butylsulfanyl-2-(4-butylsulfanyl-5-iodo-1,3-dithiol-2-ylidene)-5-iodo-1,3-dithiole |
|---|---|
| PubChem CID | 11125053 |
| Molecular Formula | C14H18I2S6 |
| Molecular Weight | 632.51 g/mol |
| Exact Mass | 631.78 |
| IUPAC Name | (2E)-4-butylsulfanyl-2-(4-butylsulfanyl-5-iodo-1,3-dithiol-2-ylidene)-5-iodo-1,3-dithiole |
| SMILES | CCCCSC1=C(I)S/C(=C2/SC(I)=C(SCCCC)S2)S1 |
| InChI | InChI=1S/C14H18I2S6/c1-3-5-7-17-11-9(15)19-13(21-11)14-20-10(16)12(22-14)18-8-6-4-2/h3-8H2,1-2H3/b14-13+ |
| InChIKey | XBNJKLFNYWIECT-BUHFOSPRSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.51 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|