C36H42N2S12 — CID 101240465
bis[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]diazene (PubChem CID 101240465) has the molecular formula C36H42N2S12 and a molecular weight of 887.55 g/mol. Its IUPAC name is bis[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]diazene.
| Compound Name | bis[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]diazene |
|---|---|
| PubChem CID | 101240465 |
| Molecular Formula | C36H42N2S12 |
| Molecular Weight | 887.55 g/mol |
| Exact Mass | 886.00 |
| IUPAC Name | bis[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]diazene |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2Sc3ccc(/N=N/c4ccc5c(c4)SC(=C4SC(SCCCC)=C(SCCCC)S4)S5)cc3S2)S1 |
| InChI | InChI=1S/C36H42N2S12/c1-5-9-17-39-29-30(40-18-10-6-2)48-35(47-29)33-43-25-15-13-23(21-27(25)45-33)37-38-24-14-16-26-28(22-24)46-34(44-26)36-49-31(41-19-11-7-3)32(50-36)42-20-12-8-4/h13-16,21-22H,5-12,17-20H2,1-4H3/b38-37+ |
| InChIKey | GDVZDRVTKVBDEN-HEFFKOSUSA-N |
| XLogP | 18.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.55 |
| LogP ≤ 5 | 18.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|