C18H21NO2S6 — CID 71441128
2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5-nitro-1,3-benzodithiole (PubChem CID 71441128) has the molecular formula C18H21NO2S6 and a molecular weight of 475.77 g/mol. Its IUPAC name is 2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5-nitro-1,3-benzodithiole.
| Compound Name | 2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5-nitro-1,3-benzodithiole |
|---|---|
| PubChem CID | 71441128 |
| Molecular Formula | C18H21NO2S6 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5-nitro-1,3-benzodithiole |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2Sc3ccc([N+](=O)[O-])cc3S2)S1 |
| InChI | InChI=1S/C18H21NO2S6/c1-3-5-9-22-15-16(23-10-6-4-2)27-18(26-15)17-24-13-8-7-12(19(20)21)11-14(13)25-17/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | OIIXPNHLKMDGJP-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|