C28H28N4O6S8 — CID 88897546
3-[[5-(3-amino-3-oxopropyl)sulfanyl-2-[4,5-bis[2-(4-nitrophenyl)ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanamide (PubChem CID 88897546) has the molecular formula C28H28N4O6S8 and a molecular weight of 773.09 g/mol. Its IUPAC name is 3-[[5-(3-amino-3-oxopropyl)sulfanyl-2-[4,5-bis[2-(4-nitrophenyl)ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanamide.
| Compound Name | 3-[[5-(3-amino-3-oxopropyl)sulfanyl-2-[4,5-bis[2-(4-nitrophenyl)ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 88897546 |
| Molecular Formula | C28H28N4O6S8 |
| Molecular Weight | 773.09 g/mol |
| Exact Mass | 771.98 |
| IUPAC Name | 3-[[5-(3-amino-3-oxopropyl)sulfanyl-2-[4,5-bis[2-(4-nitrophenyl)ethylsulfanyl]-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanamide |
| SMILES | NC(=O)CCSC1=C(SCCC(N)=O)SC(=C2SC(SCCc3ccc([N+](=O)[O-])cc3)=C(SCCc3ccc([N+](=O)[O-])cc3)S2)S1 |
| InChI | InChI=1S/C28H28N4O6S8/c29-21(33)11-15-41-25-26(42-16-12-22(30)34)46-28(45-25)27-43-23(39-13-9-17-1-5-19(6-2-17)31(35)36)24(44-27)40-14-10-18-3-7-20(8-4-18)32(37)38/h1-8H,9-16H2,(H2,29,33)(H2,30,34) |
| InChIKey | XXUXSGQNPZEAKV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.09 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|