C30H38S12 — CID 102256588
2,6-bis[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiole (PubChem CID 102256588) has the molecular formula C30H38S12 and a molecular weight of 783.44 g/mol. Its IUPAC name is 2,6-bis[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiole.
| Compound Name | 2,6-bis[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiole |
|---|---|
| PubChem CID | 102256588 |
| Molecular Formula | C30H38S12 |
| Molecular Weight | 783.44 g/mol |
| Exact Mass | 781.96 |
| IUPAC Name | 2,6-bis[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiole |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2Sc3cc4c(cc3S2)SC(=C2SC(SCCCC)=C(SCCCC)S2)S4)S1 |
| InChI | InChI=1S/C30H38S12/c1-5-9-13-31-23-24(32-14-10-6-2)40-29(39-23)27-35-19-17-21-22(18-20(19)36-27)38-28(37-21)30-41-25(33-15-11-7-3)26(42-30)34-16-12-8-4/h17-18H,5-16H2,1-4H3 |
| InChIKey | NZHNYGMOZIUXHP-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.44 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|