C17H22OS8 — CID 101155521
2-[4,5-bis(pentylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one (PubChem CID 101155521) has the molecular formula C17H22OS8 and a molecular weight of 498.90 g/mol. Its IUPAC name is 2-[4,5-bis(pentylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one.
| Compound Name | 2-[4,5-bis(pentylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one |
|---|---|
| PubChem CID | 101155521 |
| Molecular Formula | C17H22OS8 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 497.94 |
| IUPAC Name | 2-[4,5-bis(pentylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one |
| SMILES | CCCCCSC1=C(SCCCCC)SC(=C2Sc3sc(=O)sc3S2)S1 |
| InChI | InChI=1S/C17H22OS8/c1-3-5-7-9-19-11-12(20-10-8-6-4-2)22-13(21-11)14-23-15-16(24-14)26-17(18)25-15/h3-10H2,1-2H3 |
| InChIKey | AVNDGBNOFSLLGF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|