C20H26Br2S7 — CID 139195535
2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-4,6-dibromothieno[3,4-d][1,3]dithiole (PubChem CID 139195535) has the molecular formula C20H26Br2S7 and a molecular weight of 650.71 g/mol. Its IUPAC name is 2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-4,6-dibromothieno[3,4-d][1,3]dithiole.
| Compound Name | 2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-4,6-dibromothieno[3,4-d][1,3]dithiole |
|---|---|
| PubChem CID | 139195535 |
| Molecular Formula | C20H26Br2S7 |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 647.84 |
| IUPAC Name | 2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-4,6-dibromothieno[3,4-d][1,3]dithiole |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=C2Sc3c(Br)sc(Br)c3S2)S1 |
| InChI | InChI=1S/C20H26Br2S7/c1-3-5-7-9-11-23-17-18(24-12-10-8-6-4-2)29-20(28-17)19-25-13-14(26-19)16(22)27-15(13)21/h3-12H2,1-2H3 |
| InChIKey | OUDJVTLQINMPAH-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|