C24H40S8 — CID 177460538
2-[4,5-bis(nonylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol (PubChem CID 177460538) has the molecular formula C24H40S8 and a molecular weight of 585.12 g/mol. Its IUPAC name is 2-[4,5-bis(nonylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol.
| Compound Name | 2-[4,5-bis(nonylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
|---|---|
| PubChem CID | 177460538 |
| Molecular Formula | C24H40S8 |
| Molecular Weight | 585.12 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 2-[4,5-bis(nonylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
| SMILES | CCCCCCCCCSC1=C(SCCCCCCCCC)SC(=C2SC(S)=C(S)S2)S1 |
| InChI | InChI=1S/C24H40S8/c1-3-5-7-9-11-13-15-17-27-21-22(28-18-16-14-12-10-8-6-4-2)32-24(31-21)23-29-19(25)20(26)30-23/h25-26H,3-18H2,1-2H3 |
| InChIKey | HFLWRRGOBGSGTC-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.12 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|