C56H74S12 — CID 102272090
2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-5-[4-[2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]buta-1,3-diynyl]-1,3-benzodithiole (PubChem CID 102272090) has the molecular formula C56H74S12 and a molecular weight of 1132.01 g/mol. Its IUPAC name is 2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-5-[4-[2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]buta-1,3-diynyl]-1,3-benzodithiole.
| Compound Name | 2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-5-[4-[2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]buta-1,3-diynyl]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102272090 |
| Molecular Formula | C56H74S12 |
| Molecular Weight | 1132.01 g/mol |
| Exact Mass | 1130.24 |
| IUPAC Name | 2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-5-[4-[2-[4,5-bis(octylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-benzodithiol-5-yl]buta-1,3-diynyl]-1,3-benzodithiole |
| SMILES | CCCCCCCCSC1=C(SCCCCCCCC)SC(=C2Sc3ccc(C#CC#Cc4ccc5c(c4)SC(=C4SC(SCCCCCCCC)=C(SCCCCCCCC)S4)S5)cc3S2)S1 |
| InChI | InChI=1S/C56H74S12/c1-5-9-13-17-21-27-37-57-49-50(58-38-28-22-18-14-10-6-2)66-55(65-49)53-61-45-35-33-43(41-47(45)63-53)31-25-26-32-44-34-36-46-48(42-44)64-54(62-46)56-67-51(59-39-29-23-19-15-11-7-3)52(68-56)60-40-30-24-20-16-12-8-4/h33-36,41-42H,5-24,27-30,37-40H2,1-4H3 |
| InChIKey | GADNLNVPOFGVAE-UHFFFAOYSA-N |
| XLogP | 23.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1132.01 |
| LogP ≤ 5 | 23.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|