C13H12N4O2S3 — CID 9337150
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzonitrile (PubChem CID 9337150) has the molecular formula C13H12N4O2S3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzonitrile.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 9337150 |
| Molecular Formula | C13H12N4O2S3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzonitrile |
| SMILES | CCCCSc1nnc(Sc2ccc([N+](=O)[O-])cc2C#N)s1 |
| InChI | InChI=1S/C13H12N4O2S3/c1-2-3-6-20-12-15-16-13(22-12)21-11-5-4-10(17(18)19)7-9(11)8-14/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | PVBMJPVQYRGXIM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|