C14H15ClN4O3S3 — CID 30359775
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 30359775) has the molecular formula C14H15ClN4O3S3 and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 30359775 |
| Molecular Formula | C14H15ClN4O3S3 |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | CCCCSc1nnc(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)s1 |
| InChI | InChI=1S/C14H15ClN4O3S3/c1-2-3-6-23-13-17-18-14(25-13)24-8-12(20)16-11-7-9(19(21)22)4-5-10(11)15/h4-5,7H,2-3,6,8H2,1H3,(H,16,20) |
| InChIKey | UPCJQAWLWJYIGM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|