C13H14ClN5O3S2 — CID 2501995
N-(2-chloro-5-nitrophenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2501995) has the molecular formula C13H14ClN5O3S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2501995 |
| Molecular Formula | C13H14ClN5O3S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)Nc1nnc(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)s1 |
| InChI | InChI=1S/C13H14ClN5O3S2/c1-7(2)15-12-17-18-13(24-12)23-6-11(20)16-10-5-8(19(21)22)3-4-9(10)14/h3-5,7H,6H2,1-2H3,(H,15,17)(H,16,20) |
| InChIKey | PYLXVCBXYGHRJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|