C15H12ClN5O4S2 — CID 60604550
N-(2-chloro-4-nitrophenyl)-2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 60604550) has the molecular formula C15H12ClN5O4S2 and a molecular weight of 425.88 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 60604550 |
| Molecular Formula | C15H12ClN5O4S2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(NCc2ccco2)s1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H12ClN5O4S2/c16-11-6-9(21(23)24)3-4-12(11)18-13(22)8-26-15-20-19-14(27-15)17-7-10-2-1-5-25-10/h1-6H,7-8H2,(H,17,19)(H,18,22) |
| InChIKey | JIRQIISEFPYSMP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|