C13H9N5O5S2 — CID 31259202
5-(2,4-dinitrophenyl)sulfanyl-N-(furan-2-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 31259202) has the molecular formula C13H9N5O5S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)sulfanyl-N-(furan-2-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,4-dinitrophenyl)sulfanyl-N-(furan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 31259202 |
| Molecular Formula | C13H9N5O5S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 5-(2,4-dinitrophenyl)sulfanyl-N-(furan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Sc2nnc(NCc3ccco3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N5O5S2/c19-17(20)8-3-4-11(10(6-8)18(21)22)24-13-16-15-12(25-13)14-7-9-2-1-5-23-9/h1-6H,7H2,(H,14,15) |
| InChIKey | KZPMHAZWEXSPFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|