C12H13N5O3S2 — CID 60567740
4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzamide (PubChem CID 60567740) has the molecular formula C12H13N5O3S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 60567740 |
| Molecular Formula | C12H13N5O3S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzamide |
| SMILES | CCNc1nnc(Sc2ccc(C(=O)NC)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H13N5O3S2/c1-3-14-11-15-16-12(22-11)21-9-5-4-7(10(18)13-2)6-8(9)17(19)20/h4-6H,3H2,1-2H3,(H,13,18)(H,14,15) |
| InChIKey | NBNBWTCMXQDXBP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|