C14H19N5O5S3 — CID 24623855
4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 24623855) has the molecular formula C14H19N5O5S3 and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24623855 |
| Molecular Formula | C14H19N5O5S3 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCOCCCNc1nnc(Sc2ccc(S(=O)(=O)NC)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H19N5O5S3/c1-3-24-8-4-7-16-13-17-18-14(26-13)25-12-6-5-10(27(22,23)15-2)9-11(12)19(20)21/h5-6,9,15H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | XRFJVMXDWQLBEN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|