C14H16N4OS3 — CID 31259585
5-(1,3-benzothiazol-2-ylsulfanyl)-N-(3-ethoxypropyl)-1,3,4-thiadiazol-2-amine (PubChem CID 31259585) has the molecular formula C14H16N4OS3 and a molecular weight of 352.51 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanyl)-N-(3-ethoxypropyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanyl)-N-(3-ethoxypropyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 31259585 |
| Molecular Formula | C14H16N4OS3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanyl)-N-(3-ethoxypropyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOCCCNc1nnc(Sc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C14H16N4OS3/c1-2-19-9-5-8-15-12-17-18-14(21-12)22-13-16-10-6-3-4-7-11(10)20-13/h3-4,6-7H,2,5,8-9H2,1H3,(H,15,17) |
| InChIKey | OOYLIOSIAWTCAL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|