C12H15N5O3S2 — CID 17495846
N-(3-ethoxypropyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 17495846) has the molecular formula C12H15N5O3S2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-ethoxypropyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 17495846 |
| Molecular Formula | C12H15N5O3S2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(3-ethoxypropyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCOCCCNc1nnc(Sc2ncccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H15N5O3S2/c1-2-20-8-4-7-14-11-15-16-12(22-11)21-10-9(17(18)19)5-3-6-13-10/h3,5-6H,2,4,7-8H2,1H3,(H,14,15) |
| InChIKey | NNWNGOGWVATQJG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|