C20H21N5O2S3 — CID 24623849
N-(3-ethoxypropyl)-5-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 24623849) has the molecular formula C20H21N5O2S3 and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-ethoxypropyl)-5-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 24623849 |
| Molecular Formula | C20H21N5O2S3 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-(3-ethoxypropyl)-5-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCOCCCNc1nnc(Sc2ncnc3scc(-c4ccc(OC)cc4)c23)s1 |
| InChI | InChI=1S/C20H21N5O2S3/c1-3-27-10-4-9-21-19-24-25-20(30-19)29-18-16-15(11-28-17(16)22-12-23-18)13-5-7-14(26-2)8-6-13/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,21,24) |
| InChIKey | BHLCGZPKQARHMJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|