C16H14N2OS2 — CID 7674257
5-(4-methoxyphenyl)-4-prop-2-enylsulfanylthieno[2,3-d]pyrimidine (PubChem CID 7674257) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-prop-2-enylsulfanylthieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-methoxyphenyl)-4-prop-2-enylsulfanylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 7674257 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-prop-2-enylsulfanylthieno[2,3-d]pyrimidine |
| SMILES | C=CCSc1ncnc2scc(-c3ccc(OC)cc3)c12 |
| InChI | InChI=1S/C16H14N2OS2/c1-3-8-20-15-14-13(9-21-16(14)18-10-17-15)11-4-6-12(19-2)7-5-11/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | XXKJFFVAPIUFNB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|