C19H13N5O3S2 — CID 4967273
5-[(3-nitro-2-pyridinyl)sulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 4967273) has the molecular formula C19H13N5O3S2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 5-[(3-nitro-2-pyridinyl)sulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3-nitro-2-pyridinyl)sulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 4967273 |
| Molecular Formula | C19H13N5O3S2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 5-[(3-nitro-2-pyridinyl)sulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1Sc1nnc(Nc2ccc(Oc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H13N5O3S2/c25-24(26)16-7-4-12-20-17(16)28-19-23-22-18(29-19)21-13-8-10-15(11-9-13)27-14-5-2-1-3-6-14/h1-12H,(H,21,22) |
| InChIKey | HLJRYWRGIVWBBO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|