C8H6N4O2S3 — CID 17399569
2-methylsulfanyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole (PubChem CID 17399569) has the molecular formula C8H6N4O2S3 and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-methylsulfanyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-methylsulfanyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 17399569 |
| Molecular Formula | C8H6N4O2S3 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 2-methylsulfanyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole |
| SMILES | CSc1nnc(Sc2ncccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H6N4O2S3/c1-15-7-10-11-8(17-7)16-6-5(12(13)14)3-2-4-9-6/h2-4H,1H3 |
| InChIKey | VQTIGWGYIOCXJV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|