C8H7N5O2S — CID 15141760
2-[(1-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitropyridine (PubChem CID 15141760) has the molecular formula C8H7N5O2S and a molecular weight of 237.24 g/mol. Its IUPAC name is 2-[(1-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitropyridine.
| Compound Name | 2-[(1-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitropyridine |
|---|---|
| PubChem CID | 15141760 |
| Molecular Formula | C8H7N5O2S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-[(1-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitropyridine |
| SMILES | Cn1cnc(Sc2ncccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H7N5O2S/c1-12-5-10-8(11-12)16-7-6(13(14)15)3-2-4-9-7/h2-5H,1H3 |
| InChIKey | RAXUTHUAZRUGQM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|