C12H14N6O3S — CID 47079896
N,N-dimethyl-2-[3-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]acetamide (PubChem CID 47079896) has the molecular formula C12H14N6O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[3-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 47079896 |
| Molecular Formula | C12H14N6O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N,N-dimethyl-2-[3-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-yl]acetamide |
| SMILES | Cc1nnc(Sc2ncccc2[N+](=O)[O-])n1CC(=O)N(C)C |
| InChI | InChI=1S/C12H14N6O3S/c1-8-14-15-12(17(8)7-10(19)16(2)3)22-11-9(18(20)21)5-4-6-13-11/h4-6H,7H2,1-3H3 |
| InChIKey | PVJMYDUNXLZSMT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|