C13H18N6O4 — CID 133185650
ethyl 4-[(E)-N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 133185650) has the molecular formula C13H18N6O4 and a molecular weight of 322.33 g/mol. Its IUPAC name is ethyl 4-[(E)-N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 133185650 |
| Molecular Formula | C13H18N6O4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 4-[(E)-N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(N)=N/c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H18N6O4/c1-2-23-13(20)18-8-6-17(7-9-18)12(14)16-11-10(19(21)22)4-3-5-15-11/h3-5H,2,6-9H2,1H3,(H2,14,15,16) |
| InChIKey | NILVMEABDCMWDW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|