C12H16N6O3 — CID 100575509
1-[N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperidine-4-carboxamide (PubChem CID 100575509) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperidine-4-carboxamide.
| Compound Name | 1-[N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100575509 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[N'-(3-nitro-2-pyridinyl)carbamimidoyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(N)=Nc2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N6O3/c13-10(19)8-3-6-17(7-4-8)12(14)16-11-9(18(20)21)2-1-5-15-11/h1-2,5,8H,3-4,6-7H2,(H2,13,19)(H2,14,15,16) |
| InChIKey | ASFOWMKZRDXZBM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|