C15H20N6O4 — CID 133185686
N'-(3-nitro-2-pyridinyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 133185686) has the molecular formula C15H20N6O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is N'-(3-nitro-2-pyridinyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-nitro-2-pyridinyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 133185686 |
| Molecular Formula | C15H20N6O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N'-(3-nitro-2-pyridinyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ncccc1[N+](=O)[O-])N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C15H20N6O4/c16-15(18-13-11(21(23)24)3-1-5-17-13)20-8-6-19(7-9-20)14(22)12-4-2-10-25-12/h1,3,5,12H,2,4,6-10H2,(H2,16,17,18) |
| InChIKey | SQARLIRLJMPNCG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|