C19H27N3O6 — CID 119032155
[4-(4,5-diethoxy-2-nitrophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 119032155) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is [4-(4,5-diethoxy-2-nitrophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(4,5-diethoxy-2-nitrophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 119032155 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [4-(4,5-diethoxy-2-nitrophenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CCOc1cc(N2CCN(C(=O)C3CCCO3)CC2)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C19H27N3O6/c1-3-26-17-12-14(15(22(24)25)13-18(17)27-4-2)20-7-9-21(10-8-20)19(23)16-6-5-11-28-16/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | HUBNTRLJXULROB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|