C19H26N2O4 — CID 95320672
[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 95320672) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 95320672 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCCN(C(=O)[C@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-2-24-16-8-6-15(7-9-16)18(22)20-10-4-11-21(13-12-20)19(23)17-5-3-14-25-17/h6-9,17H,2-5,10-14H2,1H3/t17-/m1/s1 |
| InChIKey | XOGHNPVHCODEAR-QGZVFWFLSA-N |
| XLogP | 1.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |