C22H25N3O4 — CID 47024168
oxolan-2-yl-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]methanone (PubChem CID 47024168) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is oxolan-2-yl-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]methanone.
| Compound Name | oxolan-2-yl-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47024168 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | oxolan-2-yl-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCc2cccnc2)cc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H25N3O4/c26-21(24-10-12-25(13-11-24)22(27)20-4-2-14-28-20)18-5-7-19(8-6-18)29-16-17-3-1-9-23-15-17/h1,3,5-9,15,20H,2,4,10-14,16H2 |
| InChIKey | QUKLQTYVKQVSQT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |