C25H31N3O3 — CID 30854834
3-cyclopentyl-1-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]propan-1-one (PubChem CID 30854834) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 30854834 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-cyclopentyl-1-[4-[4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCC1CCCC1)N1CCN(C(=O)c2ccc(OCc3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c29-24(12-7-20-4-1-2-5-20)27-14-16-28(17-15-27)25(30)22-8-10-23(11-9-22)31-19-21-6-3-13-26-18-21/h3,6,8-11,13,18,20H,1-2,4-5,7,12,14-17,19H2 |
| InChIKey | FWGLSFJIDKALMN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |