C26H33N3O3 — CID 58347532
1-[4-[3-(cycloheptylmethoxy)benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 58347532) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[4-[3-(cycloheptylmethoxy)benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[4-[3-(cycloheptylmethoxy)benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 58347532 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[4-[3-(cycloheptylmethoxy)benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCN(C(=O)c2cccc(OCC3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C26H33N3O3/c30-25(17-22-9-6-12-27-19-22)28-13-15-29(16-14-28)26(31)23-10-5-11-24(18-23)32-20-21-7-3-1-2-4-8-21/h5-6,9-12,18-19,21H,1-4,7-8,13-17,20H2 |
| InChIKey | GKHXLCIQECPBJV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |