C24H30N4O3 — CID 58347728
1-[4-[3-(cyclohexylmethoxy)benzoyl]piperazin-1-yl]-2-pyridazin-3-ylethanone (PubChem CID 58347728) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[4-[3-(cyclohexylmethoxy)benzoyl]piperazin-1-yl]-2-pyridazin-3-ylethanone.
| Compound Name | 1-[4-[3-(cyclohexylmethoxy)benzoyl]piperazin-1-yl]-2-pyridazin-3-ylethanone |
|---|---|
| PubChem CID | 58347728 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-[4-[3-(cyclohexylmethoxy)benzoyl]piperazin-1-yl]-2-pyridazin-3-ylethanone |
| SMILES | O=C(Cc1cccnn1)N1CCN(C(=O)c2cccc(OCC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c29-23(17-21-9-5-11-25-26-21)27-12-14-28(15-13-27)24(30)20-8-4-10-22(16-20)31-18-19-6-2-1-3-7-19/h4-5,8-11,16,19H,1-3,6-7,12-15,17-18H2 |
| InChIKey | VWTCMJIMVPWXJR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |