C22H30N2O4 — CID 108533244
[3-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108533244) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [3-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108533244 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [3-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C22H30N2O4/c1-17(25)28-20-9-5-8-19(16-20)22(27)24-14-12-23(13-15-24)21(26)11-10-18-6-3-2-4-7-18/h5,8-9,16,18H,2-4,6-7,10-15H2,1H3 |
| InChIKey | VFWYBJSJTRNPQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|