C26H32N4O7 — CID 123471923
1-[4-[5-(cyclohexylmethoxy)pyridine-3-carbonyl]piperazin-1-yl]-2-pyridin-3-ylethanone;oxalic acid (PubChem CID 123471923) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is 1-[4-[5-(cyclohexylmethoxy)pyridine-3-carbonyl]piperazin-1-yl]-2-pyridin-3-ylethanone;oxalic acid.
| Compound Name | 1-[4-[5-(cyclohexylmethoxy)pyridine-3-carbonyl]piperazin-1-yl]-2-pyridin-3-ylethanone;oxalic acid |
|---|---|
| PubChem CID | 123471923 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 1-[4-[5-(cyclohexylmethoxy)pyridine-3-carbonyl]piperazin-1-yl]-2-pyridin-3-ylethanone;oxalic acid |
| SMILES | O=C(Cc1cccnc1)N1CCN(C(=O)c2cncc(OCC3CCCCC3)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N4O3.C2H2O4/c29-23(13-20-7-4-8-25-15-20)27-9-11-28(12-10-27)24(30)21-14-22(17-26-16-21)31-18-19-5-2-1-3-6-19;3-1(4)2(5)6/h4,7-8,14-17,19H,1-3,5-6,9-13,18H2;(H,3,4)(H,5,6) |
| InChIKey | LDKSIWZKZPEAAO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|