C27H33N3O8 — CID 123342875
oxalic acid;1-[4-[3-[2-(oxan-4-yl)ethoxy]benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 123342875) has the molecular formula C27H33N3O8 and a molecular weight of 527.57 g/mol. Its IUPAC name is oxalic acid;1-[4-[3-[2-(oxan-4-yl)ethoxy]benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | oxalic acid;1-[4-[3-[2-(oxan-4-yl)ethoxy]benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 123342875 |
| Molecular Formula | C27H33N3O8 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | oxalic acid;1-[4-[3-[2-(oxan-4-yl)ethoxy]benzoyl]piperazin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCN(C(=O)c2cccc(OCCC3CCOCC3)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H31N3O4.C2H2O4/c29-24(17-21-3-2-9-26-19-21)27-10-12-28(13-11-27)25(30)22-4-1-5-23(18-22)32-16-8-20-6-14-31-15-7-20;3-1(4)2(5)6/h1-5,9,18-20H,6-8,10-17H2;(H,3,4)(H,5,6) |
| InChIKey | OWLCIHLVJAJXNK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|