C26H25N3O5 — CID 58347609
3-[[3-[4-(2-pyridin-3-ylacetyl)piperazine-1-carbonyl]phenoxy]methyl]benzoic acid (PubChem CID 58347609) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[[3-[4-(2-pyridin-3-ylacetyl)piperazine-1-carbonyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[3-[4-(2-pyridin-3-ylacetyl)piperazine-1-carbonyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 58347609 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[[3-[4-(2-pyridin-3-ylacetyl)piperazine-1-carbonyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2cccc(C(=O)N3CCN(C(=O)Cc4cccnc4)CC3)c2)c1 |
| InChI | InChI=1S/C26H25N3O5/c30-24(15-19-5-3-9-27-17-19)28-10-12-29(13-11-28)25(31)21-6-2-8-23(16-21)34-18-20-4-1-7-22(14-20)26(32)33/h1-9,14,16-17H,10-13,15,18H2,(H,32,33) |
| InChIKey | CWNLHVLMCFZJSP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |