C26H28N4O3 — CID 58347483
1-[4-[3-(3-phenylpropoxy)benzoyl]piperazin-1-yl]-2-pyrazin-2-ylethanone (PubChem CID 58347483) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[4-[3-(3-phenylpropoxy)benzoyl]piperazin-1-yl]-2-pyrazin-2-ylethanone.
| Compound Name | 1-[4-[3-(3-phenylpropoxy)benzoyl]piperazin-1-yl]-2-pyrazin-2-ylethanone |
|---|---|
| PubChem CID | 58347483 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[4-[3-(3-phenylpropoxy)benzoyl]piperazin-1-yl]-2-pyrazin-2-ylethanone |
| SMILES | O=C(Cc1cnccn1)N1CCN(C(=O)c2cccc(OCCCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C26H28N4O3/c31-25(19-23-20-27-11-12-28-23)29-13-15-30(16-14-29)26(32)22-9-4-10-24(18-22)33-17-5-8-21-6-2-1-3-7-21/h1-4,6-7,9-12,18,20H,5,8,13-17,19H2 |
| InChIKey | YONNHYVPHUGYML-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|