C18H20N2O3 — CID 51725557
(2R)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]oxolane-2-carboxamide (PubChem CID 51725557) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51725557 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R)-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]oxolane-2-carboxamide |
| SMILES | O=C(NCc1ccc(OCc2cccnc2)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C18H20N2O3/c21-18(17-4-2-10-22-17)20-12-14-5-7-16(8-6-14)23-13-15-3-1-9-19-11-15/h1,3,5-9,11,17H,2,4,10,12-13H2,(H,20,21)/t17-/m1/s1 |
| InChIKey | UHMSFTGFRUNTDG-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |